C17H24F3N3O2 — CID 168892193
1-[(1R)-3-butyl-3-fluorocyclopentyl]-3-[[2-(difluoromethoxy)-4-pyridinyl]methyl]urea (PubChem CID 168892193) has the molecular formula C17H24F3N3O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-[(1R)-3-butyl-3-fluorocyclopentyl]-3-[[2-(difluoromethoxy)-4-pyridinyl]methyl]urea.
| Compound Name | 1-[(1R)-3-butyl-3-fluorocyclopentyl]-3-[[2-(difluoromethoxy)-4-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 168892193 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[(1R)-3-butyl-3-fluorocyclopentyl]-3-[[2-(difluoromethoxy)-4-pyridinyl]methyl]urea |
| SMILES | CCCCC1(F)CC[C@@H](NC(=O)NCc2ccnc(OC(F)F)c2)C1 |
| InChI | InChI=1S/C17H24F3N3O2/c1-2-3-6-17(20)7-4-13(10-17)23-16(24)22-11-12-5-8-21-14(9-12)25-15(18)19/h5,8-9,13,15H,2-4,6-7,10-11H2,1H3,(H2,22,23,24)/t13-,17?/m1/s1 |
| InChIKey | JDDQLQFVFLLRBT-FWJOYPJLSA-N |
| XLogP | 3.93 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |