C14H15F2N3O2 — CID 168892654
1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-(3-ethynylcyclobutyl)urea (PubChem CID 168892654) has the molecular formula C14H15F2N3O2 and a molecular weight of 295.29 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-(3-ethynylcyclobutyl)urea.
| Compound Name | 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-(3-ethynylcyclobutyl)urea |
|---|---|
| PubChem CID | 168892654 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-(3-ethynylcyclobutyl)urea |
| SMILES | C#CC1CC(NC(=O)NCc2ccnc(OC(F)F)c2)C1 |
| InChI | InChI=1S/C14H15F2N3O2/c1-2-9-5-11(6-9)19-14(20)18-8-10-3-4-17-12(7-10)21-13(15)16/h1,3-4,7,9,11,13H,5-6,8H2,(H2,18,19,20) |
| InChIKey | KMIRLHQYTHRJSE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|