C13H15F4N3O2 — CID 168892367
1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-[3-(difluoromethyl)cyclobutyl]urea (PubChem CID 168892367) has the molecular formula C13H15F4N3O2 and a molecular weight of 321.27 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-[3-(difluoromethyl)cyclobutyl]urea.
| Compound Name | 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-[3-(difluoromethyl)cyclobutyl]urea |
|---|---|
| PubChem CID | 168892367 |
| Molecular Formula | C13H15F4N3O2 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-[[2-(difluoromethoxy)-4-pyridinyl]methyl]-3-[3-(difluoromethyl)cyclobutyl]urea |
| SMILES | O=C(NCc1ccnc(OC(F)F)c1)NC1CC(C(F)F)C1 |
| InChI | InChI=1S/C13H15F4N3O2/c14-11(15)8-4-9(5-8)20-13(21)19-6-7-1-2-18-10(3-7)22-12(16)17/h1-3,8-9,11-12H,4-6H2,(H2,19,20,21) |
| InChIKey | MKNNCEDLEZXFAP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |