C15H18N4O3 — CID 133062095
tert-butyl N-[3-(2-aminopyrimidin-4-yl)oxyphenyl]carbamate (PubChem CID 133062095) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is tert-butyl N-[3-(2-aminopyrimidin-4-yl)oxyphenyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-aminopyrimidin-4-yl)oxyphenyl]carbamate |
|---|---|
| PubChem CID | 133062095 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | tert-butyl N-[3-(2-aminopyrimidin-4-yl)oxyphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Oc2ccnc(N)n2)c1 |
| InChI | InChI=1S/C15H18N4O3/c1-15(2,3)22-14(20)18-10-5-4-6-11(9-10)21-12-7-8-17-13(16)19-12/h4-9H,1-3H3,(H,18,20)(H2,16,17,19) |
| InChIKey | OALDWGJSHLSYPF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |