C17H19ClN2O3 — CID 69161019
tert-butyl N-[3-(4-amino-2-chlorophenoxy)phenyl]carbamate (PubChem CID 69161019) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is tert-butyl N-[3-(4-amino-2-chlorophenoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-amino-2-chlorophenoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 69161019 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | tert-butyl N-[3-(4-amino-2-chlorophenoxy)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Oc2ccc(N)cc2Cl)c1 |
| InChI | InChI=1S/C17H19ClN2O3/c1-17(2,3)23-16(21)20-12-5-4-6-13(10-12)22-15-8-7-11(19)9-14(15)18/h4-10H,19H2,1-3H3,(H,20,21) |
| InChIKey | MWRPTZRUFJXMMK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|