C17H18Cl2I2N2O2 — CID 162105379
tert-butyl N-(3-chloro-4-iodophenyl)carbamate;3-chloro-4-iodoaniline (PubChem CID 162105379) has the molecular formula C17H18Cl2I2N2O2 and a molecular weight of 607.06 g/mol. Its IUPAC name is tert-butyl N-(3-chloro-4-iodophenyl)carbamate;3-chloro-4-iodoaniline.
| Compound Name | tert-butyl N-(3-chloro-4-iodophenyl)carbamate;3-chloro-4-iodoaniline |
|---|---|
| PubChem CID | 162105379 |
| Molecular Formula | C17H18Cl2I2N2O2 |
| Molecular Weight | 607.06 g/mol |
| Exact Mass | 605.88 |
| IUPAC Name | tert-butyl N-(3-chloro-4-iodophenyl)carbamate;3-chloro-4-iodoaniline |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(I)c(Cl)c1.Nc1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClINO2.C6H5ClIN/c1-11(2,3)16-10(15)14-7-4-5-9(13)8(12)6-7;7-5-3-4(9)1-2-6(5)8/h4-6H,1-3H3,(H,14,15);1-3H,9H2 |
| InChIKey | ZFLAGQMYKHCSMI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.06 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|