C12H19BrN2O2 — CID 131885239
tert-butyl N-(3-amino-4-methylphenyl)carbamate;hydrobromide (PubChem CID 131885239) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is tert-butyl N-(3-amino-4-methylphenyl)carbamate;hydrobromide.
| Compound Name | tert-butyl N-(3-amino-4-methylphenyl)carbamate;hydrobromide |
|---|---|
| PubChem CID | 131885239 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | tert-butyl N-(3-amino-4-methylphenyl)carbamate;hydrobromide |
| SMILES | Br.Cc1ccc(NC(=O)OC(C)(C)C)cc1N |
| InChI | InChI=1S/C12H18N2O2.BrH/c1-8-5-6-9(7-10(8)13)14-11(15)16-12(2,3)4;/h5-7H,13H2,1-4H3,(H,14,15);1H |
| InChIKey | METDWMREXUSBGK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|