C20H27N3O4 — CID 15863515
tert-butyl N-[3-amino-4-[2-(2-amino-5-methylphenoxy)ethoxy]phenyl]carbamate (PubChem CID 15863515) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl N-[3-amino-4-[2-(2-amino-5-methylphenoxy)ethoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-4-[2-(2-amino-5-methylphenoxy)ethoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 15863515 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | tert-butyl N-[3-amino-4-[2-(2-amino-5-methylphenoxy)ethoxy]phenyl]carbamate |
| SMILES | Cc1ccc(N)c(OCCOc2ccc(NC(=O)OC(C)(C)C)cc2N)c1 |
| InChI | InChI=1S/C20H27N3O4/c1-13-5-7-15(21)18(11-13)26-10-9-25-17-8-6-14(12-16(17)22)23-19(24)27-20(2,3)4/h5-8,11-12H,9-10,21-22H2,1-4H3,(H,23,24) |
| InChIKey | KSHBNBGDEFGOIY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|