C20H27ClN2O3 — CID 119419203
N-(3-amino-4-methoxyphenyl)-5-(2,5-dimethylphenoxy)pentanamide;hydrochloride (PubChem CID 119419203) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-5-(2,5-dimethylphenoxy)pentanamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-5-(2,5-dimethylphenoxy)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119419203 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-5-(2,5-dimethylphenoxy)pentanamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)CCCCOc2cc(C)ccc2C)cc1N.Cl |
| InChI | InChI=1S/C20H26N2O3.ClH/c1-14-7-8-15(2)19(12-14)25-11-5-4-6-20(23)22-16-9-10-18(24-3)17(21)13-16;/h7-10,12-13H,4-6,11,21H2,1-3H3,(H,22,23);1H |
| InChIKey | INHQYRZHUZSHIZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|