C18H22N2O2 — CID 84553818
4-(2-aminophenoxy)-N-(3,4-dimethylphenyl)butanamide (PubChem CID 84553818) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-(2-aminophenoxy)-N-(3,4-dimethylphenyl)butanamide.
| Compound Name | 4-(2-aminophenoxy)-N-(3,4-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 84553818 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-(2-aminophenoxy)-N-(3,4-dimethylphenyl)butanamide |
| SMILES | Cc1ccc(NC(=O)CCCOc2ccccc2N)cc1C |
| InChI | InChI=1S/C18H22N2O2/c1-13-9-10-15(12-14(13)2)20-18(21)8-5-11-22-17-7-4-3-6-16(17)19/h3-4,6-7,9-10,12H,5,8,11,19H2,1-2H3,(H,20,21) |
| InChIKey | SZUWFYGJYPRPPK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|