C13H17ClN2O4 — CID 165440698
chloromethyl 2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (PubChem CID 165440698) has the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. Its IUPAC name is chloromethyl 2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate.
| Compound Name | chloromethyl 2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 165440698 |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | chloromethyl 2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)OCCl)c(N)c1 |
| InChI | InChI=1S/C13H17ClN2O4/c1-13(2,3)20-12(18)16-8-4-5-9(10(15)6-8)11(17)19-7-14/h4-6H,7,15H2,1-3H3,(H,16,18) |
| InChIKey | CYFFKVUYSMBHJS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|