C12H16BNO2 — CID 164562081
CID 164562081 (PubChem CID 164562081) has the molecular formula C12H16BNO2 and a molecular weight of 217.08 g/mol.
| Compound Name | CID 164562081 |
|---|---|
| PubChem CID | 164562081 |
| Molecular Formula | C12H16BNO2 |
| Molecular Weight | 217.08 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C12H16BNO2/c1-8-7-9(5-6-10(8)13)14-11(15)16-12(2,3)4/h5-7H,1-4H3,(H,14,15) |
| InChIKey | OUOXRSZUTFNRLU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.08 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|