C22H34BrNO7 — CID 158687232
tert-butyl N-(3-bromo-4-methylphenyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (PubChem CID 158687232) has the molecular formula C22H34BrNO7 and a molecular weight of 504.42 g/mol. Its IUPAC name is tert-butyl N-(3-bromo-4-methylphenyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate.
| Compound Name | tert-butyl N-(3-bromo-4-methylphenyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
|---|---|
| PubChem CID | 158687232 |
| Molecular Formula | C22H34BrNO7 |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | tert-butyl N-(3-bromo-4-methylphenyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cc1ccc(NC(=O)OC(C)(C)C)cc1Br |
| InChI | InChI=1S/C12H16BrNO2.C10H18O5/c1-8-5-6-9(7-10(8)13)14-11(15)16-12(2,3)4;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6/h5-7H,1-4H3,(H,14,15);1-6H3 |
| InChIKey | IFWVVBPLTQQFRC-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|