C17H31NO2 — CID 143766104
tert-butyl N-(3,5-dimethylphenyl)carbamate;ethane (PubChem CID 143766104) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is tert-butyl N-(3,5-dimethylphenyl)carbamate;ethane.
| Compound Name | tert-butyl N-(3,5-dimethylphenyl)carbamate;ethane |
|---|---|
| PubChem CID | 143766104 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | tert-butyl N-(3,5-dimethylphenyl)carbamate;ethane |
| SMILES | CC.CC.Cc1cc(C)cc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C13H19NO2.2C2H6/c1-9-6-10(2)8-11(7-9)14-12(15)16-13(3,4)5;2*1-2/h6-8H,1-5H3,(H,14,15);2*1-2H3 |
| InChIKey | KMKNWFNYWXJBKQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |