C10H12Br2N2O2 — CID 121232345
tert-butyl N-(2,6-dibromo-4-pyridinyl)carbamate (PubChem CID 121232345) has the molecular formula C10H12Br2N2O2 and a molecular weight of 352.03 g/mol. Its IUPAC name is tert-butyl N-(2,6-dibromo-4-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(2,6-dibromo-4-pyridinyl)carbamate |
|---|---|
| PubChem CID | 121232345 |
| Molecular Formula | C10H12Br2N2O2 |
| Molecular Weight | 352.03 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | tert-butyl N-(2,6-dibromo-4-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Br)nc(Br)c1 |
| InChI | InChI=1S/C10H12Br2N2O2/c1-10(2,3)16-9(15)13-6-4-7(11)14-8(12)5-6/h4-5H,1-3H3,(H,13,14,15) |
| InChIKey | ICVRVLLQWSDSCV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.03 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|