C11H13ClF2N2O3 — CID 177331060
tert-butyl N-[2-chloro-6-(difluoromethoxy)-4-pyridinyl]carbamate (PubChem CID 177331060) has the molecular formula C11H13ClF2N2O3 and a molecular weight of 294.69 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-6-(difluoromethoxy)-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-chloro-6-(difluoromethoxy)-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 177331060 |
| Molecular Formula | C11H13ClF2N2O3 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | tert-butyl N-[2-chloro-6-(difluoromethoxy)-4-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cl)nc(OC(F)F)c1 |
| InChI | InChI=1S/C11H13ClF2N2O3/c1-11(2,3)19-10(17)15-6-4-7(12)16-8(5-6)18-9(13)14/h4-5,9H,1-3H3,(H,15,16,17) |
| InChIKey | IQOKLJPHYUQNJW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|