C10H15F2N3O3 — CID 156696295
tert-butyl N-[3-(difluoromethoxy)-1-methylpyrazol-5-yl]carbamate (PubChem CID 156696295) has the molecular formula C10H15F2N3O3 and a molecular weight of 263.24 g/mol. Its IUPAC name is tert-butyl N-[3-(difluoromethoxy)-1-methylpyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[3-(difluoromethoxy)-1-methylpyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 156696295 |
| Molecular Formula | C10H15F2N3O3 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | tert-butyl N-[3-(difluoromethoxy)-1-methylpyrazol-5-yl]carbamate |
| SMILES | Cn1nc(OC(F)F)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H15F2N3O3/c1-10(2,3)18-9(16)13-6-5-7(14-15(6)4)17-8(11)12/h5,8H,1-4H3,(H,13,16) |
| InChIKey | WAVPOGKXYHWGAI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |