C9H16N4O2 — CID 146680472
tert-butyl N-(5-amino-1-methylpyrazol-3-yl)carbamate (PubChem CID 146680472) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is tert-butyl N-(5-amino-1-methylpyrazol-3-yl)carbamate.
| Compound Name | tert-butyl N-(5-amino-1-methylpyrazol-3-yl)carbamate |
|---|---|
| PubChem CID | 146680472 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | tert-butyl N-(5-amino-1-methylpyrazol-3-yl)carbamate |
| SMILES | Cn1nc(NC(=O)OC(C)(C)C)cc1N |
| InChI | InChI=1S/C9H16N4O2/c1-9(2,3)15-8(14)11-7-5-6(10)13(4)12-7/h5H,10H2,1-4H3,(H,11,12,14) |
| InChIKey | OZFJXZMYQQRIFF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |