C12H19N3O4 — CID 14488339
ethyl 1-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-5-carboxylate (PubChem CID 14488339) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is ethyl 1-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-5-carboxylate.
| Compound Name | ethyl 1-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 14488339 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethyl 1-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)OC(C)(C)C)nn1C |
| InChI | InChI=1S/C12H19N3O4/c1-6-18-10(16)8-7-9(14-15(8)5)13-11(17)19-12(2,3)4/h7H,6H2,1-5H3,(H,13,14,17) |
| InChIKey | IAPAEGWHIHWVDG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |