C10H12BrN3O3 — CID 54181653
ethyl 3-(2-bromoprop-2-enoylamino)-1-methylpyrazole-5-carboxylate (PubChem CID 54181653) has the molecular formula C10H12BrN3O3 and a molecular weight of 302.13 g/mol. Its IUPAC name is ethyl 3-(2-bromoprop-2-enoylamino)-1-methylpyrazole-5-carboxylate.
| Compound Name | ethyl 3-(2-bromoprop-2-enoylamino)-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 54181653 |
| Molecular Formula | C10H12BrN3O3 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | ethyl 3-(2-bromoprop-2-enoylamino)-1-methylpyrazole-5-carboxylate |
| SMILES | C=C(Br)C(=O)Nc1cc(C(=O)OCC)n(C)n1 |
| InChI | InChI=1S/C10H12BrN3O3/c1-4-17-10(16)7-5-8(13-14(7)3)12-9(15)6(2)11/h5H,2,4H2,1,3H3,(H,12,13,15) |
| InChIKey | PCFNJQUBZGNBCU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|