C18H23N3O6 — CID 156537612
ethyl 1,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dioxoquinoxaline-6-carboxylate (PubChem CID 156537612) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is ethyl 1,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dioxoquinoxaline-6-carboxylate.
| Compound Name | ethyl 1,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dioxoquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 156537612 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | ethyl 1,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dioxoquinoxaline-6-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cc1NC(=O)OC(C)(C)C)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C18H23N3O6/c1-7-26-16(24)10-8-12-13(21(6)15(23)14(22)20(12)5)9-11(10)19-17(25)27-18(2,3)4/h8-9H,7H2,1-6H3,(H,19,25) |
| InChIKey | IZLILNGVGIDDLX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|