C14H16Br2O4 — CID 23502195
2-O-tert-butyl 1-O-ethyl 4,5-dibromobenzene-1,2-dicarboxylate (PubChem CID 23502195) has the molecular formula C14H16Br2O4 and a molecular weight of 408.09 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-ethyl 4,5-dibromobenzene-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-ethyl 4,5-dibromobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23502195 |
| Molecular Formula | C14H16Br2O4 |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | 2-O-tert-butyl 1-O-ethyl 4,5-dibromobenzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1cc(Br)c(Br)cc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H16Br2O4/c1-5-19-12(17)8-6-10(15)11(16)7-9(8)13(18)20-14(2,3)4/h6-7H,5H2,1-4H3 |
| InChIKey | QXXYOVNYDBHVIW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |