C18H25BrO5 — CID 156759792
ditert-butyl 2-bromo-5-(methoxymethyl)benzene-1,4-dicarboxylate (PubChem CID 156759792) has the molecular formula C18H25BrO5 and a molecular weight of 401.30 g/mol. Its IUPAC name is ditert-butyl 2-bromo-5-(methoxymethyl)benzene-1,4-dicarboxylate.
| Compound Name | ditert-butyl 2-bromo-5-(methoxymethyl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 156759792 |
| Molecular Formula | C18H25BrO5 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | ditert-butyl 2-bromo-5-(methoxymethyl)benzene-1,4-dicarboxylate |
| SMILES | COCc1cc(C(=O)OC(C)(C)C)c(Br)cc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25BrO5/c1-17(2,3)23-15(20)12-9-14(19)13(8-11(12)10-22-7)16(21)24-18(4,5)6/h8-9H,10H2,1-7H3 |
| InChIKey | AGIZPVPQCRLKIU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |