C17H20BrNO3 — CID 162527661
tert-butyl N-[7-bromo-2-(methoxymethyl)naphthalen-1-yl]carbamate (PubChem CID 162527661) has the molecular formula C17H20BrNO3 and a molecular weight of 366.26 g/mol. Its IUPAC name is tert-butyl N-[7-bromo-2-(methoxymethyl)naphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[7-bromo-2-(methoxymethyl)naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 162527661 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | tert-butyl N-[7-bromo-2-(methoxymethyl)naphthalen-1-yl]carbamate |
| SMILES | COCc1ccc2ccc(Br)cc2c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H20BrNO3/c1-17(2,3)22-16(20)19-15-12(10-21-4)6-5-11-7-8-13(18)9-14(11)15/h5-9H,10H2,1-4H3,(H,19,20) |
| InChIKey | GZJGKVLYOZAJPS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |