C11H13BrFNO2 — CID 22736228
tert-butyl N-(4-bromo-2-fluorophenyl)carbamate (PubChem CID 22736228) has the molecular formula C11H13BrFNO2 and a molecular weight of 290.13 g/mol. Its IUPAC name is tert-butyl N-(4-bromo-2-fluorophenyl)carbamate.
| Compound Name | tert-butyl N-(4-bromo-2-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 22736228 |
| Molecular Formula | C11H13BrFNO2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | tert-butyl N-(4-bromo-2-fluorophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C11H13BrFNO2/c1-11(2,3)16-10(15)14-9-5-4-7(12)6-8(9)13/h4-6H,1-3H3,(H,14,15) |
| InChIKey | DMHILFAMOKMHSO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |