C12H12BrF4NO2 — CID 91756947
tert-butyl N-[4-bromo-2-fluoro-5-(trifluoromethyl)phenyl]carbamate (PubChem CID 91756947) has the molecular formula C12H12BrF4NO2 and a molecular weight of 358.13 g/mol. Its IUPAC name is tert-butyl N-[4-bromo-2-fluoro-5-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-bromo-2-fluoro-5-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 91756947 |
| Molecular Formula | C12H12BrF4NO2 |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | tert-butyl N-[4-bromo-2-fluoro-5-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)c(Br)cc1F |
| InChI | InChI=1S/C12H12BrF4NO2/c1-11(2,3)20-10(19)18-9-4-6(12(15,16)17)7(13)5-8(9)14/h4-5H,1-3H3,(H,18,19) |
| InChIKey | VWHCVHGUWHAYRH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |