C12H16FNO4S — CID 174589000
[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methanesulfinic acid (PubChem CID 174589000) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is [3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methanesulfinic acid.
| Compound Name | [3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174589000 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | [3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methanesulfinic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CS(=O)O)cc1F |
| InChI | InChI=1S/C12H16FNO4S/c1-12(2,3)18-11(15)14-10-5-4-8(6-9(10)13)7-19(16)17/h4-6H,7H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | OBASRDCPWHZORT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|