C15H20FNO2S — CID 170479329
tert-butyl N-[2-fluoro-4-(4-sulfanylbut-1-enyl)phenyl]carbamate (PubChem CID 170479329) has the molecular formula C15H20FNO2S and a molecular weight of 297.40 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-4-(4-sulfanylbut-1-enyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-4-(4-sulfanylbut-1-enyl)phenyl]carbamate |
|---|---|
| PubChem CID | 170479329 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | tert-butyl N-[2-fluoro-4-(4-sulfanylbut-1-enyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C=CCCS)cc1F |
| InChI | InChI=1S/C15H20FNO2S/c1-15(2,3)19-14(18)17-13-8-7-11(10-12(13)16)6-4-5-9-20/h4,6-8,10,20H,5,9H2,1-3H3,(H,17,18) |
| InChIKey | UDVBXKJKOMDDDT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|