C16H21FN2O3 — CID 169466457
tert-butyl N-[4-(3-acetamidoprop-1-enyl)-2-fluorophenyl]carbamate (PubChem CID 169466457) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is tert-butyl N-[4-(3-acetamidoprop-1-enyl)-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-acetamidoprop-1-enyl)-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 169466457 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | tert-butyl N-[4-(3-acetamidoprop-1-enyl)-2-fluorophenyl]carbamate |
| SMILES | CC(=O)NCC=Cc1ccc(NC(=O)OC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C16H21FN2O3/c1-11(20)18-9-5-6-12-7-8-14(13(17)10-12)19-15(21)22-16(2,3)4/h5-8,10H,9H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | ZECGJWVGVZFXGF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |