C15H17FN2O2 — CID 170800686
tert-butyl N-[4-(3-cyanoprop-1-enyl)-2-fluorophenyl]carbamate (PubChem CID 170800686) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is tert-butyl N-[4-(3-cyanoprop-1-enyl)-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-cyanoprop-1-enyl)-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 170800686 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | tert-butyl N-[4-(3-cyanoprop-1-enyl)-2-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C=CCC#N)cc1F |
| InChI | InChI=1S/C15H17FN2O2/c1-15(2,3)20-14(19)18-13-8-7-11(10-12(13)16)6-4-5-9-17/h4,6-8,10H,5H2,1-3H3,(H,18,19) |
| InChIKey | CTWSPWAURQLWPK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |