C17H24N2O5 — CID 22563949
tert-butyl N-[4-formyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate (PubChem CID 22563949) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is tert-butyl N-[4-formyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-formyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 22563949 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | tert-butyl N-[4-formyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C=O)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24N2O5/c1-16(2,3)23-14(21)18-12-8-7-11(10-20)9-13(12)19-15(22)24-17(4,5)6/h7-10H,1-6H3,(H,18,21)(H,19,22) |
| InChIKey | ZHBHOCIIHAZBLY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|