C16H25BN2O6 — CID 68785692
[3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (PubChem CID 68785692) has the molecular formula C16H25BN2O6 and a molecular weight of 352.20 g/mol. Its IUPAC name is [3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid.
| Compound Name | [3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
|---|---|
| PubChem CID | 68785692 |
| Molecular Formula | C16H25BN2O6 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(B(O)O)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25BN2O6/c1-15(2,3)24-13(20)18-11-8-7-10(17(22)23)9-12(11)19-14(21)25-16(4,5)6/h7-9,22-23H,1-6H3,(H,18,20)(H,19,21) |
| InChIKey | OLHUPXIXFDSXGK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|