C14H19FN2O3 — CID 56783735
tert-butyl N-[4-fluoro-2-(propanoylamino)phenyl]carbamate (PubChem CID 56783735) has the molecular formula C14H19FN2O3 and a molecular weight of 282.32 g/mol. Its IUPAC name is tert-butyl N-[4-fluoro-2-(propanoylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-fluoro-2-(propanoylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 56783735 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | tert-butyl N-[4-fluoro-2-(propanoylamino)phenyl]carbamate |
| SMILES | CCC(=O)Nc1cc(F)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19FN2O3/c1-5-12(18)16-11-8-9(15)6-7-10(11)17-13(19)20-14(2,3)4/h6-8H,5H2,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | SAMGDMSJANYIGY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |