C16H20FN3O2 — CID 107240774
tert-butyl N-[4-fluoro-2-(1H-pyrrol-2-ylmethylamino)phenyl]carbamate (PubChem CID 107240774) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is tert-butyl N-[4-fluoro-2-(1H-pyrrol-2-ylmethylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-fluoro-2-(1H-pyrrol-2-ylmethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 107240774 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | tert-butyl N-[4-fluoro-2-(1H-pyrrol-2-ylmethylamino)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)cc1NCc1ccc[nH]1 |
| InChI | InChI=1S/C16H20FN3O2/c1-16(2,3)22-15(21)20-13-7-6-11(17)9-14(13)19-10-12-5-4-8-18-12/h4-9,18-19H,10H2,1-3H3,(H,20,21) |
| InChIKey | IZDRGIKYEFJWGF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |