C16H18FIN2O3 — CID 107240771
tert-butyl N-[4-fluoro-2-[(5-iodofuran-2-yl)methylamino]phenyl]carbamate (PubChem CID 107240771) has the molecular formula C16H18FIN2O3 and a molecular weight of 432.23 g/mol. Its IUPAC name is tert-butyl N-[4-fluoro-2-[(5-iodofuran-2-yl)methylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-fluoro-2-[(5-iodofuran-2-yl)methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 107240771 |
| Molecular Formula | C16H18FIN2O3 |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | tert-butyl N-[4-fluoro-2-[(5-iodofuran-2-yl)methylamino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)cc1NCc1ccc(I)o1 |
| InChI | InChI=1S/C16H18FIN2O3/c1-16(2,3)23-15(21)20-12-6-4-10(17)8-13(12)19-9-11-5-7-14(18)22-11/h4-8,19H,9H2,1-3H3,(H,20,21) |
| InChIKey | CIIAIFXWRIJXLY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|