C27H36F4N2O7 — CID 159153378
tert-butyl N-(2,4-difluorophenyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;2,4-difluoroaniline (PubChem CID 159153378) has the molecular formula C27H36F4N2O7 and a molecular weight of 576.58 g/mol. Its IUPAC name is tert-butyl N-(2,4-difluorophenyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;2,4-difluoroaniline.
| Compound Name | tert-butyl N-(2,4-difluorophenyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;2,4-difluoroaniline |
|---|---|
| PubChem CID | 159153378 |
| Molecular Formula | C27H36F4N2O7 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | tert-butyl N-(2,4-difluorophenyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;2,4-difluoroaniline |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)cc1F.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Nc1ccc(F)cc1F |
| InChI | InChI=1S/C11H13F2NO2.C10H18O5.C6H5F2N/c1-11(2,3)16-10(15)14-9-5-4-7(12)6-8(9)13;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;7-4-1-2-6(9)5(8)3-4/h4-6H,1-3H3,(H,14,15);1-6H3;1-3H,9H2 |
| InChIKey | KJOXLFSSBLVITG-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|