C11H15FN2O3 — CID 135394494
tert-butyl N-(3-amino-6-fluoro-2-hydroxyphenyl)carbamate (PubChem CID 135394494) has the molecular formula C11H15FN2O3 and a molecular weight of 242.25 g/mol. Its IUPAC name is tert-butyl N-(3-amino-6-fluoro-2-hydroxyphenyl)carbamate.
| Compound Name | tert-butyl N-(3-amino-6-fluoro-2-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 135394494 |
| Molecular Formula | C11H15FN2O3 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | tert-butyl N-(3-amino-6-fluoro-2-hydroxyphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(F)ccc(N)c1O |
| InChI | InChI=1S/C11H15FN2O3/c1-11(2,3)17-10(16)14-8-6(12)4-5-7(13)9(8)15/h4-5,15H,13H2,1-3H3,(H,14,16) |
| InChIKey | VGTNFLLVRPCJHC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|