C15H20FNO3 — CID 11242993
tert-butyl N-[2-fluoro-6-(2-methylpropanoyl)phenyl]carbamate (PubChem CID 11242993) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-6-(2-methylpropanoyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-6-(2-methylpropanoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 11242993 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl N-[2-fluoro-6-(2-methylpropanoyl)phenyl]carbamate |
| SMILES | CC(C)C(=O)c1cccc(F)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20FNO3/c1-9(2)13(18)10-7-6-8-11(16)12(10)17-14(19)20-15(3,4)5/h6-9H,1-5H3,(H,17,19) |
| InChIKey | ZBLNEPOSJWSKHS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |