C15H20FNO5 — CID 175150154
methyl 3-[3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]propanoate (PubChem CID 175150154) has the molecular formula C15H20FNO5 and a molecular weight of 313.33 g/mol. Its IUPAC name is methyl 3-[3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]propanoate.
| Compound Name | methyl 3-[3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]propanoate |
|---|---|
| PubChem CID | 175150154 |
| Molecular Formula | C15H20FNO5 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | methyl 3-[3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]propanoate |
| SMILES | COC(=O)CCOc1cccc(F)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20FNO5/c1-15(2,3)22-14(19)17-13-10(16)6-5-7-11(13)21-9-8-12(18)20-4/h5-7H,8-9H2,1-4H3,(H,17,19) |
| InChIKey | KCIJFDGJTLHHQD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |