C14H19F2N3O2S — CID 84554082
tert-butyl N-[2-[(2,6-difluorophenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 84554082) has the molecular formula C14H19F2N3O2S and a molecular weight of 331.39 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,6-difluorophenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2,6-difluorophenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 84554082 |
| Molecular Formula | C14H19F2N3O2S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | tert-butyl N-[2-[(2,6-difluorophenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=S)Nc1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2N3O2S/c1-14(2,3)21-13(20)18-8-7-17-12(22)19-11-9(15)5-4-6-10(11)16/h4-6H,7-8H2,1-3H3,(H,18,20)(H2,17,19,22) |
| InChIKey | KUCMWYTVUZROCF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|