C15H19ClF3N3O2S — CID 84551483
tert-butyl N-[2-[[4-chloro-2-(trifluoromethyl)phenyl]carbamothioylamino]ethyl]carbamate (PubChem CID 84551483) has the molecular formula C15H19ClF3N3O2S and a molecular weight of 397.85 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-chloro-2-(trifluoromethyl)phenyl]carbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-chloro-2-(trifluoromethyl)phenyl]carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 84551483 |
| Molecular Formula | C15H19ClF3N3O2S |
| Molecular Weight | 397.85 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | tert-butyl N-[2-[[4-chloro-2-(trifluoromethyl)phenyl]carbamothioylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=S)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H19ClF3N3O2S/c1-14(2,3)24-13(23)21-7-6-20-12(25)22-11-5-4-9(16)8-10(11)15(17,18)19/h4-5,8H,6-7H2,1-3H3,(H,21,23)(H2,20,22,25) |
| InChIKey | VDUMZLOAYUSFQB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|