C12H14ClF3N2S — CID 19676134
1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(2-methylpropyl)thiourea (PubChem CID 19676134) has the molecular formula C12H14ClF3N2S and a molecular weight of 310.77 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 19676134 |
| Molecular Formula | C12H14ClF3N2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C12H14ClF3N2S/c1-7(2)6-17-11(19)18-10-4-3-8(13)5-9(10)12(14,15)16/h3-5,7H,6H2,1-2H3,(H2,17,18,19) |
| InChIKey | OLQXDHMOKKBAII-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|