C16H23N3O4S — CID 84556078
4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioylamino]methyl]benzoic acid (PubChem CID 84556078) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 84556078 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioylamino]methyl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCNC(=S)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H23N3O4S/c1-16(2,3)23-15(22)18-9-8-17-14(24)19-10-11-4-6-12(7-5-11)13(20)21/h4-7H,8-10H2,1-3H3,(H,18,22)(H,20,21)(H2,17,19,24) |
| InChIKey | WQPZRDSTYMWBJZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|