C16H22FNO5 — CID 89312277
[3-(fluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 2-methylpropanoate (PubChem CID 89312277) has the molecular formula C16H22FNO5 and a molecular weight of 327.35 g/mol. Its IUPAC name is [3-(fluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 2-methylpropanoate.
| Compound Name | [3-(fluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 89312277 |
| Molecular Formula | C16H22FNO5 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | [3-(fluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1cccc(OCF)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22FNO5/c1-10(2)14(19)22-12-8-6-7-11(21-9-17)13(12)18-15(20)23-16(3,4)5/h6-8,10H,9H2,1-5H3,(H,18,20) |
| InChIKey | HHVUQRUXQBABDY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|