C20H31NO4 — CID 130300874
[2,6-di(propan-2-yl)phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 130300874) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 130300874 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)Oc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C20H31NO4/c1-12(2)15-10-9-11-16(13(3)4)17(15)24-18(22)14(5)21-19(23)25-20(6,7)8/h9-14H,1-8H3,(H,21,23) |
| InChIKey | MZBQRTXSNVQRCD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|