C13H19NO3 — CID 117064047
[2,6-di(propan-2-yl)phenyl] N-hydroxycarbamate (PubChem CID 117064047) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] N-hydroxycarbamate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] N-hydroxycarbamate |
|---|---|
| PubChem CID | 117064047 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] N-hydroxycarbamate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)NO |
| InChI | InChI=1S/C13H19NO3/c1-8(2)10-6-5-7-11(9(3)4)12(10)17-13(15)14-16/h5-9,16H,1-4H3,(H,14,15) |
| InChIKey | QTITVRXVGKVEKH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|