C17H25NO2 — CID 67493330
[2,6-di(propan-2-yl)phenyl] pyrrolidine-1-carboxylate (PubChem CID 67493330) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] pyrrolidine-1-carboxylate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67493330 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] pyrrolidine-1-carboxylate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)N1CCCC1 |
| InChI | InChI=1S/C17H25NO2/c1-12(2)14-8-7-9-15(13(3)4)16(14)20-17(19)18-10-5-6-11-18/h7-9,12-13H,5-6,10-11H2,1-4H3 |
| InChIKey | VTKYDOROXSMWDA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |