About ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate
ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate (PubChem CID 142555031) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate |
| PubChem CID | 142555031 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate |
| SMILES | CC.Cc1ccc(OC(=O)N2CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C17H19NO2.C2H6/c1-13-9-10-16(15-8-4-3-7-14(13)15)20-17(19)18-11-5-2-6-12-18;1-2/h3-4,7-10H,2,5-6,11-12H2,1H3;1-2H3 |
| InChIKey | PNRVWFUHSHKXNK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate?
The IUPAC name of ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate (CID 142555031) is ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate.
What is the SMILES notation for ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate?
The canonical SMILES for ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate is CC.Cc1ccc(OC(=O)N2CCCCC2)c2ccccc12.
What is the InChIKey of ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate?
The InChIKey is PNRVWFUHSHKXNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2.C2H6/c1-13-9-10-16(15-8-4-3-7-14(13)15)20-17(19)18-11-5-2-6-12-18;1-2/h3-4,7-10H,2,5-6,11-12H2,1H3;1-2H3.
What are the key properties of ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate?
ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate has a molecular weight of 299.41 g/mol, XLogP of 5.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-methylnaphthalen-1-yl) piperidine-1-carboxylate is sourced from PubChem (CID 142555031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).