C13H15NO3 — CID 116819303
(2-methylphenyl) 3-oxopiperidine-1-carboxylate (PubChem CID 116819303) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (2-methylphenyl) 3-oxopiperidine-1-carboxylate.
| Compound Name | (2-methylphenyl) 3-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 116819303 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (2-methylphenyl) 3-oxopiperidine-1-carboxylate |
| SMILES | Cc1ccccc1OC(=O)N1CCCC(=O)C1 |
| InChI | InChI=1S/C13H15NO3/c1-10-5-2-3-7-12(10)17-13(16)14-8-4-6-11(15)9-14/h2-3,5,7H,4,6,8-9H2,1H3 |
| InChIKey | PQGHXOKMDKBHEZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |