About (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate
(2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate (PubChem CID 116819412) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate |
| PubChem CID | 116819412 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCC(=O)C2)c(C)c1 |
| InChI | InChI=1S/C13H15NO3/c1-9-3-4-12(10(2)7-9)17-13(16)14-6-5-11(15)8-14/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | ZONKLWGJGLRLIT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate?
The IUPAC name of (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate (CID 116819412) is (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate.
What is the SMILES notation for (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate?
The canonical SMILES for (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate is Cc1ccc(OC(=O)N2CCC(=O)C2)c(C)c1.
What is the InChIKey of (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate?
The InChIKey is ZONKLWGJGLRLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-9-3-4-12(10(2)7-9)17-13(16)14-6-5-11(15)8-14/h3-4,7H,5-6,8H2,1-2H3.
What are the key properties of (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate?
(2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate has a molecular weight of 233.27 g/mol, XLogP of 2.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethylphenyl) 3-oxopyrrolidine-1-carboxylate is sourced from PubChem (CID 116819412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).